C28H40F2O2 — CID 58021450
2-[4-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]cyclohexyl]-5-ethenyloxane (PubChem CID 58021450) has the molecular formula C28H40F2O2 and a molecular weight of 446.62 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]cyclohexyl]-5-ethenyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]cyclohexyl]-5-ethenyloxane |
|---|---|
| PubChem CID | 58021450 |
| Molecular Formula | C28H40F2O2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]cyclohexyl]-5-ethenyloxane |
| SMILES | C=CC1CCC(C2CCC(C3CCC(c4ccc(OCCC)c(F)c4F)CC3)CC2)OC1 |
| InChI | InChI=1S/C28H40F2O2/c1-3-17-31-26-16-14-24(27(29)28(26)30)22-10-6-20(7-11-22)21-8-12-23(13-9-21)25-15-5-19(4-2)18-32-25/h4,14,16,19-23,25H,2-3,5-13,15,17-18H2,1H3 |
| InChIKey | CIPUGADEQBBIJF-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|