C37H56F2O2 — CID 58021203
2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]oxane (PubChem CID 58021203) has the molecular formula C37H56F2O2 and a molecular weight of 570.85 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]oxane.
| Compound Name | 2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 58021203 |
| Molecular Formula | C37H56F2O2 |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.42 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]oxane |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(C4CCC(c5ccc(OCCC)c(F)c5F)CC4)OC3)CC2)CC1 |
| InChI | InChI=1S/C37H56F2O2/c1-3-5-6-7-26-8-10-27(11-9-26)28-12-14-29(15-13-28)32-20-22-34(41-25-32)31-18-16-30(17-19-31)33-21-23-35(40-24-4-2)37(39)36(33)38/h3,5,21,23,26-32,34H,4,6-20,22,24-25H2,1-2H3/b5-3+ |
| InChIKey | HLBXHLVHRGJLET-HWKANZROSA-N |
| XLogP | 10.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|