C34H52F2O2 — CID 154607209
5-[4-[2-(4-butoxy-2,3-difluorophenyl)ethyl]cyclohexyl]-2-[4-[(E)-pent-3-enyl]cyclohexyl]oxane (PubChem CID 154607209) has the molecular formula C34H52F2O2 and a molecular weight of 530.78 g/mol. Its IUPAC name is 5-[4-[2-(4-butoxy-2,3-difluorophenyl)ethyl]cyclohexyl]-2-[4-[(E)-pent-3-enyl]cyclohexyl]oxane.
| Compound Name | 5-[4-[2-(4-butoxy-2,3-difluorophenyl)ethyl]cyclohexyl]-2-[4-[(E)-pent-3-enyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 154607209 |
| Molecular Formula | C34H52F2O2 |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | 5-[4-[2-(4-butoxy-2,3-difluorophenyl)ethyl]cyclohexyl]-2-[4-[(E)-pent-3-enyl]cyclohexyl]oxane |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(CCc4ccc(OCCCC)c(F)c4F)CC3)CO2)CC1 |
| InChI | InChI=1S/C34H52F2O2/c1-3-5-7-8-25-11-16-28(17-12-25)31-21-20-30(24-38-31)27-14-9-26(10-15-27)13-18-29-19-22-32(34(36)33(29)35)37-23-6-4-2/h3,5,19,22,25-28,30-31H,4,6-18,20-21,23-24H2,1-2H3/b5-3+ |
| InChIKey | KQJBLSWPGDNEFU-HWKANZROSA-N |
| XLogP | 9.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|