C30H46F2O2 — CID 67957680
(5S)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-5-(4-pentylcyclohexyl)oxane (PubChem CID 67957680) has the molecular formula C30H46F2O2 and a molecular weight of 476.69 g/mol. Its IUPAC name is (5S)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-5-(4-pentylcyclohexyl)oxane.
| Compound Name | (5S)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-5-(4-pentylcyclohexyl)oxane |
|---|---|
| PubChem CID | 67957680 |
| Molecular Formula | C30H46F2O2 |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | (5S)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-5-(4-pentylcyclohexyl)oxane |
| SMILES | CCCCCC1CCC([C@@H]2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)OC2)CC1 |
| InChI | InChI=1S/C30H46F2O2/c1-3-5-6-7-21-8-10-22(11-9-21)25-16-18-27(34-20-25)24-14-12-23(13-15-24)26-17-19-28(33-4-2)30(32)29(26)31/h17,19,21-25,27H,3-16,18,20H2,1-2H3/t21?,22?,23?,24?,25-,27?/m1/s1 |
| InChIKey | UMMNXURBBPJQMP-IRIQHTINSA-N |
| XLogP | 8.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|