C29H44F2O3 — CID 67968441
2-[5-(4-ethoxy-2,3-difluorophenyl)oxan-2-yl]-5-(4-pentylcyclohexyl)oxane (PubChem CID 67968441) has the molecular formula C29H44F2O3 and a molecular weight of 478.66 g/mol. Its IUPAC name is 2-[5-(4-ethoxy-2,3-difluorophenyl)oxan-2-yl]-5-(4-pentylcyclohexyl)oxane.
| Compound Name | 2-[5-(4-ethoxy-2,3-difluorophenyl)oxan-2-yl]-5-(4-pentylcyclohexyl)oxane |
|---|---|
| PubChem CID | 67968441 |
| Molecular Formula | C29H44F2O3 |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 2-[5-(4-ethoxy-2,3-difluorophenyl)oxan-2-yl]-5-(4-pentylcyclohexyl)oxane |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CO3)OC2)CC1 |
| InChI | InChI=1S/C29H44F2O3/c1-3-5-6-7-20-8-10-21(11-9-20)22-12-15-25(33-18-22)26-16-13-23(19-34-26)24-14-17-27(32-4-2)29(31)28(24)30/h14,17,20-23,25-26H,3-13,15-16,18-19H2,1-2H3 |
| InChIKey | QVEQQCTXEQSLDK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|