C27H40F2O3 — CID 67968505
5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-(6-propyloxan-3-yl)oxane (PubChem CID 67968505) has the molecular formula C27H40F2O3 and a molecular weight of 450.61 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-(6-propyloxan-3-yl)oxane.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-(6-propyloxan-3-yl)oxane |
|---|---|
| PubChem CID | 67968505 |
| Molecular Formula | C27H40F2O3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-(6-propyloxan-3-yl)oxane |
| SMILES | CCCC1CCC(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CO2)CO1 |
| InChI | InChI=1S/C27H40F2O3/c1-3-5-22-12-10-21(17-31-22)24-14-11-20(16-32-24)18-6-8-19(9-7-18)23-13-15-25(30-4-2)27(29)26(23)28/h13,15,18-22,24H,3-12,14,16-17H2,1-2H3 |
| InChIKey | DVLZTWDLKJRJAI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |