C29H35F3O3 — CID 118890899
6-ethoxy-3,4,5-trifluoro-2-[4-(6-propyloxan-3-yl)cyclohexyl]-9H-xanthene (PubChem CID 118890899) has the molecular formula C29H35F3O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 6-ethoxy-3,4,5-trifluoro-2-[4-(6-propyloxan-3-yl)cyclohexyl]-9H-xanthene.
| Compound Name | 6-ethoxy-3,4,5-trifluoro-2-[4-(6-propyloxan-3-yl)cyclohexyl]-9H-xanthene |
|---|---|
| PubChem CID | 118890899 |
| Molecular Formula | C29H35F3O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 6-ethoxy-3,4,5-trifluoro-2-[4-(6-propyloxan-3-yl)cyclohexyl]-9H-xanthene |
| SMILES | CCCC1CCC(C2CCC(c3cc4c(c(F)c3F)Oc3c(ccc(OCC)c3F)C4)CC2)CO1 |
| InChI | InChI=1S/C29H35F3O3/c1-3-5-22-12-10-20(16-34-22)17-6-8-18(9-7-17)23-15-21-14-19-11-13-24(33-4-2)26(31)28(19)35-29(21)27(32)25(23)30/h11,13,15,17-18,20,22H,3-10,12,14,16H2,1-2H3 |
| InChIKey | QMXCIRULWKWGNH-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |