C32H41F3O4 — CID 144734076
5-(4-methoxycyclohexyl)-2-propyloxane;4,5,6-trifluoro-7-propyl-9H-xanthene-3-carbaldehyde (PubChem CID 144734076) has the molecular formula C32H41F3O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 5-(4-methoxycyclohexyl)-2-propyloxane;4,5,6-trifluoro-7-propyl-9H-xanthene-3-carbaldehyde.
| Compound Name | 5-(4-methoxycyclohexyl)-2-propyloxane;4,5,6-trifluoro-7-propyl-9H-xanthene-3-carbaldehyde |
|---|---|
| PubChem CID | 144734076 |
| Molecular Formula | C32H41F3O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 5-(4-methoxycyclohexyl)-2-propyloxane;4,5,6-trifluoro-7-propyl-9H-xanthene-3-carbaldehyde |
| SMILES | CCCC1CCC(C2CCC(OC)CC2)CO1.CCCc1cc2c(c(F)c1F)Oc1c(ccc(C=O)c1F)C2 |
| InChI | InChI=1S/C17H13F3O2.C15H28O2/c1-2-3-9-6-12-7-10-4-5-11(8-21)14(19)16(10)22-17(12)15(20)13(9)18;1-3-4-15-10-7-13(11-17-15)12-5-8-14(16-2)9-6-12/h4-6,8H,2-3,7H2,1H3;12-15H,3-11H2,1-2H3 |
| InChIKey | XCJCOIGHFJBQOB-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|