C31H39F3O3 — CID 118891203
6-ethoxy-3,4,5-trifluoro-2-[6-[2-(4-propylcyclohexyl)ethyl]oxan-3-yl]-9H-xanthene (PubChem CID 118891203) has the molecular formula C31H39F3O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 6-ethoxy-3,4,5-trifluoro-2-[6-[2-(4-propylcyclohexyl)ethyl]oxan-3-yl]-9H-xanthene.
| Compound Name | 6-ethoxy-3,4,5-trifluoro-2-[6-[2-(4-propylcyclohexyl)ethyl]oxan-3-yl]-9H-xanthene |
|---|---|
| PubChem CID | 118891203 |
| Molecular Formula | C31H39F3O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 6-ethoxy-3,4,5-trifluoro-2-[6-[2-(4-propylcyclohexyl)ethyl]oxan-3-yl]-9H-xanthene |
| SMILES | CCCC1CCC(CCC2CCC(c3cc4c(c(F)c3F)Oc3c(ccc(OCC)c3F)C4)CO2)CC1 |
| InChI | InChI=1S/C31H39F3O3/c1-3-5-19-6-8-20(9-7-19)10-13-24-14-11-22(18-36-24)25-17-23-16-21-12-15-26(35-4-2)28(33)30(21)37-31(23)29(34)27(25)32/h12,15,17,19-20,22,24H,3-11,13-14,16,18H2,1-2H3 |
| InChIKey | PTSWCMVBXPWSQT-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |