C22H23F3O4 — CID 118891138
2-ethoxy-3,4,5-trifluoro-6-(5-propyl-1,3-dioxan-2-yl)-9H-xanthene (PubChem CID 118891138) has the molecular formula C22H23F3O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-ethoxy-3,4,5-trifluoro-6-(5-propyl-1,3-dioxan-2-yl)-9H-xanthene.
| Compound Name | 2-ethoxy-3,4,5-trifluoro-6-(5-propyl-1,3-dioxan-2-yl)-9H-xanthene |
|---|---|
| PubChem CID | 118891138 |
| Molecular Formula | C22H23F3O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-ethoxy-3,4,5-trifluoro-6-(5-propyl-1,3-dioxan-2-yl)-9H-xanthene |
| SMILES | CCCC1COC(c2ccc3c(c2F)Oc2c(cc(OCC)c(F)c2F)C3)OC1 |
| InChI | InChI=1S/C22H23F3O4/c1-3-5-12-10-27-22(28-11-12)15-7-6-13-8-14-9-16(26-4-2)18(24)19(25)21(14)29-20(13)17(15)23/h6-7,9,12,22H,3-5,8,10-11H2,1-2H3 |
| InChIKey | RWHKIFHDHHCSEJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |