C27H31F3O3 — CID 118891059
6-ethoxy-3,4,5-trifluoro-2-[[4-[(E)-pent-3-enyl]cyclohexyl]methoxy]-9H-xanthene (PubChem CID 118891059) has the molecular formula C27H31F3O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is 6-ethoxy-3,4,5-trifluoro-2-[[4-[(E)-pent-3-enyl]cyclohexyl]methoxy]-9H-xanthene.
| Compound Name | 6-ethoxy-3,4,5-trifluoro-2-[[4-[(E)-pent-3-enyl]cyclohexyl]methoxy]-9H-xanthene |
|---|---|
| PubChem CID | 118891059 |
| Molecular Formula | C27H31F3O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 6-ethoxy-3,4,5-trifluoro-2-[[4-[(E)-pent-3-enyl]cyclohexyl]methoxy]-9H-xanthene |
| SMILES | C/C=C/CCC1CCC(COc2cc3c(c(F)c2F)Oc2c(ccc(OCC)c2F)C3)CC1 |
| InChI | InChI=1S/C27H31F3O3/c1-3-5-6-7-17-8-10-18(11-9-17)16-32-22-15-20-14-19-12-13-21(31-4-2)24(29)26(19)33-27(20)25(30)23(22)28/h3,5,12-13,15,17-18H,4,6-11,14,16H2,1-2H3/b5-3+ |
| InChIKey | UFNKIORWNBLCKJ-HWKANZROSA-N |
| XLogP | 7.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|