C26H36F2O2 — CID 89276327
2-[2,3-difluoro-4-[[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]methoxy]phenyl]oxirane (PubChem CID 89276327) has the molecular formula C26H36F2O2 and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]methoxy]phenyl]oxirane.
| Compound Name | 2-[2,3-difluoro-4-[[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]methoxy]phenyl]oxirane |
|---|---|
| PubChem CID | 89276327 |
| Molecular Formula | C26H36F2O2 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[2,3-difluoro-4-[[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]methoxy]phenyl]oxirane |
| SMILES | C/C=C/CCC1CCC(C2CCC(COc3ccc(C4CO4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C26H36F2O2/c1-2-3-4-5-18-6-10-20(11-7-18)21-12-8-19(9-13-21)16-29-23-15-14-22(24-17-30-24)25(27)26(23)28/h2-3,14-15,18-21,24H,4-13,16-17H2,1H3/b3-2+ |
| InChIKey | IYPGJICULJDWCB-NSCUHMNNSA-N |
| XLogP | 7.38 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|