C31H44ClFO — CID 89046705
2-[3-chloro-2-fluoro-4-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]phenyl]oxirane (PubChem CID 89046705) has the molecular formula C31H44ClFO and a molecular weight of 487.14 g/mol. Its IUPAC name is 2-[3-chloro-2-fluoro-4-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]phenyl]oxirane.
| Compound Name | 2-[3-chloro-2-fluoro-4-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89046705 |
| Molecular Formula | C31H44ClFO |
| Molecular Weight | 487.14 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 2-[3-chloro-2-fluoro-4-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]phenyl]oxirane |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(c4ccc(C5CO5)c(F)c4Cl)CC3)CC2)CC1 |
| InChI | InChI=1S/C31H44ClFO/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-12-24(13-11-23)25-14-16-26(17-15-25)27-18-19-28(29-20-34-29)31(33)30(27)32/h2-3,18-19,21-26,29H,4-17,20H2,1H3/b3-2+ |
| InChIKey | RRGGITWCSSLBHN-NSCUHMNNSA-N |
| XLogP | 9.79 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.14 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|