C27H36F2O — CID 89203836
2-[2,3-difluoro-4-[4-[4-[(E)-hept-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]oxirane (PubChem CID 89203836) has the molecular formula C27H36F2O and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[4-[4-[(E)-hept-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]oxirane.
| Compound Name | 2-[2,3-difluoro-4-[4-[4-[(E)-hept-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]oxirane |
|---|---|
| PubChem CID | 89203836 |
| Molecular Formula | C27H36F2O |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 2-[2,3-difluoro-4-[4-[4-[(E)-hept-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]oxirane |
| SMILES | CCC/C=C/CCC1CCC(C2CC=C(c3ccc(C4CO4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C27H36F2O/c1-2-3-4-5-6-7-19-8-10-20(11-9-19)21-12-14-22(15-13-21)23-16-17-24(25-18-30-25)27(29)26(23)28/h4-5,14,16-17,19-21,25H,2-3,6-13,15,18H2,1H3/b5-4+ |
| InChIKey | XPOXDAZBZJTMTA-SNAWJCMRSA-N |
| XLogP | 8.16 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|