C22H26F2O2 — CID 89203743
2-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl]acetaldehyde (PubChem CID 89203743) has the molecular formula C22H26F2O2 and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl]acetaldehyde.
| Compound Name | 2-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 89203743 |
| Molecular Formula | C22H26F2O2 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl]acetaldehyde |
| SMILES | O=CCC1CCC(C2CC=C(c3ccc(C4CO4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C22H26F2O2/c23-21-18(9-10-19(22(21)24)20-13-26-20)17-7-5-16(6-8-17)15-3-1-14(2-4-15)11-12-25/h7,9-10,12,14-16,20H,1-6,8,11,13H2 |
| InChIKey | QVRKJZUJNTYHPY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|