C33H30F4O4 — CID 88893789
[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl] 4-(2,3-difluoro-4-hydroxyphenyl)benzoate (PubChem CID 88893789) has the molecular formula C33H30F4O4 and a molecular weight of 566.59 g/mol. Its IUPAC name is [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl] 4-(2,3-difluoro-4-hydroxyphenyl)benzoate.
| Compound Name | [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl] 4-(2,3-difluoro-4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 88893789 |
| Molecular Formula | C33H30F4O4 |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohex-3-en-1-yl]cyclohexyl] 4-(2,3-difluoro-4-hydroxyphenyl)benzoate |
| SMILES | O=C(OC1CCC(C2CC=C(c3ccc(C4CO4)c(F)c3F)CC2)CC1)c1ccc(-c2ccc(O)c(F)c2F)cc1 |
| InChI | InChI=1S/C33H30F4O4/c34-29-24(13-14-26(31(29)36)28-17-40-28)20-3-1-18(2-4-20)19-9-11-23(12-10-19)41-33(39)22-7-5-21(6-8-22)25-15-16-27(38)32(37)30(25)35/h3,5-8,13-16,18-19,23,28,38H,1-2,4,9-12,17H2 |
| InChIKey | JWRIBHFTUPNWNI-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|