C30H24F6O3 — CID 88967650
[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2,3-difluorophenyl]cyclohex-3-en-1-yl] 2,3-difluoro-4-propylbenzoate (PubChem CID 88967650) has the molecular formula C30H24F6O3 and a molecular weight of 546.51 g/mol. Its IUPAC name is [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2,3-difluorophenyl]cyclohex-3-en-1-yl] 2,3-difluoro-4-propylbenzoate.
| Compound Name | [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2,3-difluorophenyl]cyclohex-3-en-1-yl] 2,3-difluoro-4-propylbenzoate |
|---|---|
| PubChem CID | 88967650 |
| Molecular Formula | C30H24F6O3 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-2,3-difluorophenyl]cyclohex-3-en-1-yl] 2,3-difluoro-4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)OC2CC=C(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C30H24F6O3/c1-2-3-16-6-9-22(29(36)24(16)31)30(37)39-17-7-4-15(5-8-17)18-10-11-19(26(33)25(18)32)20-12-13-21(23-14-38-23)28(35)27(20)34/h4,6,9-13,17,23H,2-3,5,7-8,14H2,1H3 |
| InChIKey | NHPKDGYJURRTJS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|