C29H32F4O3 — CID 88964012
[4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-(oxiran-2-yl)benzoate (PubChem CID 88964012) has the molecular formula C29H32F4O3 and a molecular weight of 504.56 g/mol. Its IUPAC name is [4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-(oxiran-2-yl)benzoate.
| Compound Name | [4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-(oxiran-2-yl)benzoate |
|---|---|
| PubChem CID | 88964012 |
| Molecular Formula | C29H32F4O3 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-(oxiran-2-yl)benzoate |
| SMILES | CCC1CCC(c2ccc(C3CCC(OC(=O)c4ccc(C5CO5)c(F)c4F)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H32F4O3/c1-2-16-3-5-17(6-4-16)20-11-12-21(26(31)25(20)30)18-7-9-19(10-8-18)36-29(34)23-14-13-22(24-15-35-24)27(32)28(23)33/h11-14,16-19,24H,2-10,15H2,1H3 |
| InChIKey | YXWPMTWPHUAKJE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|