About [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate
[4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate (PubChem CID 89430950) has the molecular formula C28H33F3O4
and a molecular weight of 490.56 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate.
Molecular Properties
| Compound Name | [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate |
| PubChem CID | 89430950 |
| Molecular Formula | C28H33F3O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate |
| SMILES | CCOc1ccc(C(=O)OC2CCC(c3ccc(C4CCC(OC)CC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C28H33F3O4/c1-3-34-21-12-13-24(25(29)16-21)28(32)35-20-10-6-18(7-11-20)23-15-14-22(26(30)27(23)31)17-4-8-19(33-2)9-5-17/h12-20H,3-11H2,1-2H3 |
| InChIKey | XVLVKQCQBBTYGS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate?
The IUPAC name of [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate (CID 89430950) is [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate.
What is the SMILES notation for [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate?
The canonical SMILES for [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate is CCOc1ccc(C(=O)OC2CCC(c3ccc(C4CCC(OC)CC4)c(F)c3F)CC2)c(F)c1.
What is the InChIKey of [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate?
The InChIKey is XVLVKQCQBBTYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33F3O4/c1-3-34-21-12-13-24(25(29)16-21)28(32)35-20-10-6-18(7-11-20)23-15-14-22(26(30)27(23)31)17-4-8-19(33-2)9-5-17/h12-20H,3-11H2,1-2H3.
What are the key properties of [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate?
[4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate has a molecular weight of 490.56 g/mol, XLogP of 7.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]cyclohexyl] 4-ethoxy-2-fluorobenzoate is sourced from PubChem (CID 89430950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).