C28H26F4O4 — CID 89124559
[4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-(4-methoxycyclohexyl)benzoate (PubChem CID 89124559) has the molecular formula C28H26F4O4 and a molecular weight of 502.50 g/mol. Its IUPAC name is [4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-(4-methoxycyclohexyl)benzoate.
| Compound Name | [4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-(4-methoxycyclohexyl)benzoate |
|---|---|
| PubChem CID | 89124559 |
| Molecular Formula | C28H26F4O4 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-(4-methoxycyclohexyl)benzoate |
| SMILES | CCOc1ccc(-c2ccc(OC(=O)c3ccc(C4CCC(OC)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H26F4O4/c1-3-35-23-15-14-21(25(30)27(23)32)17-6-10-19(11-7-17)36-28(33)22-13-12-20(24(29)26(22)31)16-4-8-18(34-2)9-5-16/h6-7,10-16,18H,3-5,8-9H2,1-2H3 |
| InChIKey | NVBSWNYLAPDFIX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|