C29H22F4O4 — CID 89124858
[4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]benzoate (PubChem CID 89124858) has the molecular formula C29H22F4O4 and a molecular weight of 510.48 g/mol. Its IUPAC name is [4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]benzoate.
| Compound Name | [4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 89124858 |
| Molecular Formula | C29H22F4O4 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [4-(4-ethoxy-2,3-difluorophenyl)phenyl] 2,3-difluoro-4-[4-(1-hydroxyethyl)phenyl]benzoate |
| SMILES | CCOc1ccc(-c2ccc(OC(=O)c3ccc(-c4ccc(C(C)O)cc4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C29H22F4O4/c1-3-36-24-15-14-22(26(31)28(24)33)19-8-10-20(11-9-19)37-29(35)23-13-12-21(25(30)27(23)32)18-6-4-17(5-7-18)16(2)34/h4-16,34H,3H2,1-2H3 |
| InChIKey | YPNCSYHIHNAUKT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|