C35H42F4O4 — CID 67677156
[4-(2,3-difluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-(2-fluorooctoxy)benzoate (PubChem CID 67677156) has the molecular formula C35H42F4O4 and a molecular weight of 602.71 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-(2-fluorooctoxy)benzoate.
| Compound Name | [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-(2-fluorooctoxy)benzoate |
|---|---|
| PubChem CID | 67677156 |
| Molecular Formula | C35H42F4O4 |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-(2-fluorooctoxy)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OCC(F)CCCCCC)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C35H42F4O4/c1-3-5-7-9-10-12-22-41-32-21-20-29(33(38)34(32)39)25-14-16-27(17-15-25)43-35(40)30-19-18-28(23-31(30)37)42-24-26(36)13-11-8-6-4-2/h14-21,23,26H,3-13,22,24H2,1-2H3 |
| InChIKey | NXYFQRIETNAUFL-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|