C39H35F2O5 — CID 10676494
CID 10676494 (PubChem CID 10676494) has the molecular formula C39H35F2O5 and a molecular weight of 621.70 g/mol.
| Compound Name | CID 10676494 |
|---|---|
| PubChem CID | 10676494 |
| Molecular Formula | C39H35F2O5 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | — |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)c4cccc([C]5[CH][CH][CH][CH]5)c4)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C39H35F2O5/c1-2-3-4-5-6-9-25-44-35-24-23-34(36(40)37(35)41)28-15-19-32(20-16-28)45-38(42)29-17-21-33(22-18-29)46-39(43)31-14-10-13-30(26-31)27-11-7-8-12-27/h7-8,10-24,26H,2-6,9,25H2,1H3 |
| InChIKey | BCVRMRQLUQJGIU-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|