C35H44F2O3 — CID 14495686
(4-octylphenyl) 4-(2,3-difluoro-4-octoxyphenyl)benzoate (PubChem CID 14495686) has the molecular formula C35H44F2O3 and a molecular weight of 550.73 g/mol. Its IUPAC name is (4-octylphenyl) 4-(2,3-difluoro-4-octoxyphenyl)benzoate.
| Compound Name | (4-octylphenyl) 4-(2,3-difluoro-4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14495686 |
| Molecular Formula | C35H44F2O3 |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | (4-octylphenyl) 4-(2,3-difluoro-4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(CCCCCCCC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C35H44F2O3/c1-3-5-7-9-11-13-15-27-16-22-30(23-17-27)40-35(38)29-20-18-28(19-21-29)31-24-25-32(34(37)33(31)36)39-26-14-12-10-8-6-4-2/h16-25H,3-15,26H2,1-2H3 |
| InChIKey | IFNDOTYOVNGXDV-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|