C37H44F2O7 — CID 101009534
[4-(4-octan-2-yloxycarbonylphenoxy)carbonylphenyl] 2,3-difluoro-4-octoxybenzoate (PubChem CID 101009534) has the molecular formula C37H44F2O7 and a molecular weight of 638.75 g/mol. Its IUPAC name is [4-(4-octan-2-yloxycarbonylphenoxy)carbonylphenyl] 2,3-difluoro-4-octoxybenzoate.
| Compound Name | [4-(4-octan-2-yloxycarbonylphenoxy)carbonylphenyl] 2,3-difluoro-4-octoxybenzoate |
|---|---|
| PubChem CID | 101009534 |
| Molecular Formula | C37H44F2O7 |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | [4-(4-octan-2-yloxycarbonylphenoxy)carbonylphenyl] 2,3-difluoro-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C(=O)OC(C)CCCCCC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H44F2O7/c1-4-6-8-10-11-13-25-43-32-24-23-31(33(38)34(32)39)37(42)46-30-21-17-28(18-22-30)36(41)45-29-19-15-27(16-20-29)35(40)44-26(3)14-12-9-7-5-2/h15-24,26H,4-14,25H2,1-3H3 |
| InChIKey | VCMVCWYYXCDSEG-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|