C37H39F9O6 — CID 102037735
[4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 2,3-difluoro-4-[5-(2,2,3,3,4,4,4-heptafluorobutoxy)pentoxy]benzoate (PubChem CID 102037735) has the molecular formula C37H39F9O6 and a molecular weight of 750.70 g/mol. Its IUPAC name is [4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 2,3-difluoro-4-[5-(2,2,3,3,4,4,4-heptafluorobutoxy)pentoxy]benzoate.
| Compound Name | [4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 2,3-difluoro-4-[5-(2,2,3,3,4,4,4-heptafluorobutoxy)pentoxy]benzoate |
|---|---|
| PubChem CID | 102037735 |
| Molecular Formula | C37H39F9O6 |
| Molecular Weight | 750.70 g/mol |
| Exact Mass | 750.26 |
| IUPAC Name | [4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 2,3-difluoro-4-[5-(2,2,3,3,4,4,4-heptafluorobutoxy)pentoxy]benzoate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCOCC(F)(F)C(F)(F)C(F)(F)F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C37H39F9O6/c1-3-4-5-7-10-24(2)51-33(47)27-13-11-25(12-14-27)26-15-17-28(18-16-26)52-34(48)29-19-20-30(32(39)31(29)38)50-22-9-6-8-21-49-23-35(40,41)36(42,43)37(44,45)46/h11-20,24H,3-10,21-23H2,1-2H3/t24-/m0/s1 |
| InChIKey | RUEGMKXCKDDZFG-DEOSSOPVSA-N |
| XLogP | 10.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.70 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|