C35H36F8O6 — CID 102054757
[4-(4-octan-2-yloxycarbonylphenyl)phenyl] 3-fluoro-4-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propoxy]benzoate (PubChem CID 102054757) has the molecular formula C35H36F8O6 and a molecular weight of 704.65 g/mol. Its IUPAC name is [4-(4-octan-2-yloxycarbonylphenyl)phenyl] 3-fluoro-4-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propoxy]benzoate.
| Compound Name | [4-(4-octan-2-yloxycarbonylphenyl)phenyl] 3-fluoro-4-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propoxy]benzoate |
|---|---|
| PubChem CID | 102054757 |
| Molecular Formula | C35H36F8O6 |
| Molecular Weight | 704.65 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | [4-(4-octan-2-yloxycarbonylphenyl)phenyl] 3-fluoro-4-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propoxy]benzoate |
| SMILES | CCCCCCC(C)OC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(OCCCOCC(F)(F)C(F)(F)C(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C35H36F8O6/c1-3-4-5-6-8-23(2)48-31(44)26-11-9-24(10-12-26)25-13-16-28(17-14-25)49-32(45)27-15-18-30(29(36)21-27)47-20-7-19-46-22-33(37,38)34(39,40)35(41,42)43/h9-18,21,23H,3-8,19-20,22H2,1-2H3 |
| InChIKey | XJTFBFJPQNIZEP-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.65 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|