C39H44F8O6 — CID 132606363
[4-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate (PubChem CID 132606363) has the molecular formula C39H44F8O6 and a molecular weight of 760.76 g/mol. Its IUPAC name is [4-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate.
| Compound Name | [4-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate |
|---|---|
| PubChem CID | 132606363 |
| Molecular Formula | C39H44F8O6 |
| Molecular Weight | 760.76 g/mol |
| Exact Mass | 760.30 |
| IUPAC Name | [4-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate |
| SMILES | CCCCCC[C@@H](C)OC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCCCOCC(F)(F)C(F)(F)C(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C39H44F8O6/c1-3-4-5-9-12-27(2)52-35(48)30-15-13-28(14-16-30)29-17-20-32(21-18-29)53-36(49)31-19-22-34(33(40)25-31)51-24-11-8-6-7-10-23-50-26-37(41,42)38(43,44)39(45,46)47/h13-22,25,27H,3-12,23-24,26H2,1-2H3/t27-/m1/s1 |
| InChIKey | GVYRHMRLMWGZFE-HHHXNRCGSA-N |
| XLogP | 11.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.76 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|