C39H49FO7 — CID 67828715
[4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-(2-octoxypropanoyloxy)benzoate (PubChem CID 67828715) has the molecular formula C39H49FO7 and a molecular weight of 648.81 g/mol. Its IUPAC name is [4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-(2-octoxypropanoyloxy)benzoate.
| Compound Name | [4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-(2-octoxypropanoyloxy)benzoate |
|---|---|
| PubChem CID | 67828715 |
| Molecular Formula | C39H49FO7 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | [4-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]phenyl] 3-fluoro-4-(2-octoxypropanoyloxy)benzoate |
| SMILES | CCCCCCCCOC(C)C(=O)Oc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)O[C@@H](C)CCCCCC)cc3)cc2)cc1F |
| InChI | InChI=1S/C39H49FO7/c1-5-7-9-11-12-14-26-44-29(4)37(41)47-36-25-22-33(27-35(36)40)39(43)46-34-23-20-31(21-24-34)30-16-18-32(19-17-30)38(42)45-28(3)15-13-10-8-6-2/h16-25,27-29H,5-15,26H2,1-4H3/t28-,29?/m0/s1 |
| InChIKey | PHUKOBZZEQMGII-XLTVJXRZSA-N |
| XLogP | 9.90 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|