C40H44F8O6 — CID 132525808
[4-[4-[(2S)-1-cyclohexylpropan-2-yl]oxycarbonylphenyl]phenyl] 2-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate (PubChem CID 132525808) has the molecular formula C40H44F8O6 and a molecular weight of 772.77 g/mol. Its IUPAC name is [4-[4-[(2S)-1-cyclohexylpropan-2-yl]oxycarbonylphenyl]phenyl] 2-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate.
| Compound Name | [4-[4-[(2S)-1-cyclohexylpropan-2-yl]oxycarbonylphenyl]phenyl] 2-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate |
|---|---|
| PubChem CID | 132525808 |
| Molecular Formula | C40H44F8O6 |
| Molecular Weight | 772.77 g/mol |
| Exact Mass | 772.30 |
| IUPAC Name | [4-[4-[(2S)-1-cyclohexylpropan-2-yl]oxycarbonylphenyl]phenyl] 2-fluoro-4-[7-(2,2,3,3,4,4,4-heptafluorobutoxy)heptoxy]benzoate |
| SMILES | C[C@@H](CC1CCCCC1)OC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCCCOCC(F)(F)C(F)(F)C(F)(F)F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C40H44F8O6/c1-27(24-28-10-6-5-7-11-28)53-36(49)31-14-12-29(13-15-31)30-16-18-32(19-17-30)54-37(50)34-21-20-33(25-35(34)41)52-23-9-4-2-3-8-22-51-26-38(42,43)39(44,45)40(46,47)48/h12-21,25,27-28H,2-11,22-24,26H2,1H3/t27-/m0/s1 |
| InChIKey | AYRQJDCEOXOVGZ-MHZLTWQESA-N |
| XLogP | 11.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.77 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|