C36H41F3O5 — CID 139614882
[4-(1-cyclohexyl-2,2,2-trifluoroethoxy)carbonylphenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 139614882) has the molecular formula C36H41F3O5 and a molecular weight of 610.71 g/mol. Its IUPAC name is [4-(1-cyclohexyl-2,2,2-trifluoroethoxy)carbonylphenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-(1-cyclohexyl-2,2,2-trifluoroethoxy)carbonylphenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 139614882 |
| Molecular Formula | C36H41F3O5 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | [4-(1-cyclohexyl-2,2,2-trifluoroethoxy)carbonylphenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C4CCCCC4)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H41F3O5/c1-2-3-4-5-6-10-25-42-31-21-17-27(18-22-31)26-13-15-29(16-14-26)34(40)43-32-23-19-30(20-24-32)35(41)44-33(36(37,38)39)28-11-8-7-9-12-28/h13-24,28,33H,2-12,25H2,1H3 |
| InChIKey | OXTIEFQRMZBBIV-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|