C37H50F2O6Si2 — CID 58679640
[4-[(2R)-7-[dimethyl(trimethylsilyloxy)silyl]heptan-2-yl]oxycarbonylphenyl] 4-(2,3-difluoro-4-pentoxyphenyl)benzoate (PubChem CID 58679640) has the molecular formula C37H50F2O6Si2 and a molecular weight of 684.97 g/mol. Its IUPAC name is [4-[(2R)-7-[dimethyl(trimethylsilyloxy)silyl]heptan-2-yl]oxycarbonylphenyl] 4-(2,3-difluoro-4-pentoxyphenyl)benzoate.
| Compound Name | [4-[(2R)-7-[dimethyl(trimethylsilyloxy)silyl]heptan-2-yl]oxycarbonylphenyl] 4-(2,3-difluoro-4-pentoxyphenyl)benzoate |
|---|---|
| PubChem CID | 58679640 |
| Molecular Formula | C37H50F2O6Si2 |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | [4-[(2R)-7-[dimethyl(trimethylsilyloxy)silyl]heptan-2-yl]oxycarbonylphenyl] 4-(2,3-difluoro-4-pentoxyphenyl)benzoate |
| SMILES | CCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@H](C)CCCCC[Si](C)(C)O[Si](C)(C)C)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H50F2O6Si2/c1-8-9-12-25-42-33-24-23-32(34(38)35(33)39)28-15-17-29(18-16-28)37(41)44-31-21-19-30(20-22-31)36(40)43-27(2)14-11-10-13-26-47(6,7)45-46(3,4)5/h15-24,27H,8-14,25-26H2,1-7H3/t27-/m1/s1 |
| InChIKey | CRKYSWDZGAFRGW-HHHXNRCGSA-N |
| XLogP | 10.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|