C29H29F3O6 — CID 67677838
[3-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-methoxycarbonyloxybenzoate (PubChem CID 67677838) has the molecular formula C29H29F3O6 and a molecular weight of 530.54 g/mol. Its IUPAC name is [3-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-methoxycarbonyloxybenzoate.
| Compound Name | [3-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-methoxycarbonyloxybenzoate |
|---|---|
| PubChem CID | 67677838 |
| Molecular Formula | C29H29F3O6 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | [3-fluoro-4-(3-fluoro-4-octoxyphenyl)phenyl] 2-fluoro-4-methoxycarbonyloxybenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)OC)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C29H29F3O6/c1-3-4-5-6-7-8-15-36-27-14-9-19(16-26(27)32)22-12-10-20(17-24(22)30)37-28(33)23-13-11-21(18-25(23)31)38-29(34)35-2/h9-14,16-18H,3-8,15H2,1-2H3 |
| InChIKey | WAUUCGULFCUINL-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|