C36H47F3O2 — CID 101044437
1-(4-decoxyphenyl)-2,3-difluoro-4-[4-[(2R)-2-fluorooctoxy]phenyl]benzene (PubChem CID 101044437) has the molecular formula C36H47F3O2 and a molecular weight of 568.76 g/mol. Its IUPAC name is 1-(4-decoxyphenyl)-2,3-difluoro-4-[4-[(2R)-2-fluorooctoxy]phenyl]benzene.
| Compound Name | 1-(4-decoxyphenyl)-2,3-difluoro-4-[4-[(2R)-2-fluorooctoxy]phenyl]benzene |
|---|---|
| PubChem CID | 101044437 |
| Molecular Formula | C36H47F3O2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 1-(4-decoxyphenyl)-2,3-difluoro-4-[4-[(2R)-2-fluorooctoxy]phenyl]benzene |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(-c3ccc(OC[C@H](F)CCCCCC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C36H47F3O2/c1-3-5-7-9-10-11-12-14-26-40-31-20-16-28(17-21-31)33-24-25-34(36(39)35(33)38)29-18-22-32(23-19-29)41-27-30(37)15-13-8-6-4-2/h16-25,30H,3-15,26-27H2,1-2H3/t30-/m1/s1 |
| InChIKey | HWFYPBLOVDZGHT-SSEXGKCCSA-N |
| XLogP | 11.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|