C15H11F5O2 — CID 19436006
1-ethoxy-2,3-difluoro-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 19436006) has the molecular formula C15H11F5O2 and a molecular weight of 318.24 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 19436006 |
| Molecular Formula | C15H11F5O2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | CCOc1ccc(-c2ccc(OC(F)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C15H11F5O2/c1-2-21-12-8-7-11(13(16)14(12)17)9-3-5-10(6-4-9)22-15(18,19)20/h3-8H,2H2,1H3 |
| InChIKey | HMMVUZUCOXTOGW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |