C19H16F2OS — CID 172603717
2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-methylthiophene (PubChem CID 172603717) has the molecular formula C19H16F2OS and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-methylthiophene.
| Compound Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 172603717 |
| Molecular Formula | C19H16F2OS |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-methylthiophene |
| SMILES | CCOc1ccc(-c2ccc(-c3ccc(C)s3)cc2)c(F)c1F |
| InChI | InChI=1S/C19H16F2OS/c1-3-22-16-10-9-15(18(20)19(16)21)13-5-7-14(8-6-13)17-11-4-12(2)23-17/h4-11H,3H2,1-2H3 |
| InChIKey | OXMNHXLUEPGKDN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |