C27H26F2O — CID 139334431
1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylphenyl)cyclohex-2-en-1-yl]phenyl]benzene (PubChem CID 139334431) has the molecular formula C27H26F2O and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylphenyl)cyclohex-2-en-1-yl]phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylphenyl)cyclohex-2-en-1-yl]phenyl]benzene |
|---|---|
| PubChem CID | 139334431 |
| Molecular Formula | C27H26F2O |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylphenyl)cyclohex-2-en-1-yl]phenyl]benzene |
| SMILES | CCOc1ccc(-c2ccc(C3C=CC(c4ccc(C)cc4)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H26F2O/c1-3-30-25-17-16-24(26(28)27(25)29)23-14-12-22(13-15-23)21-10-8-20(9-11-21)19-6-4-18(2)5-7-19/h4-8,10,12-17,20-21H,3,9,11H2,1-2H3 |
| InChIKey | WDJIAYXMBBXDCK-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|