C22H27F2NO — CID 131994381
2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexyl]ethanamine (PubChem CID 131994381) has the molecular formula C22H27F2NO and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexyl]ethanamine.
| Compound Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexyl]ethanamine |
|---|---|
| PubChem CID | 131994381 |
| Molecular Formula | C22H27F2NO |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexyl]ethanamine |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(CCN)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C22H27F2NO/c1-2-26-20-12-11-19(21(23)22(20)24)18-9-7-17(8-10-18)16-5-3-15(4-6-16)13-14-25/h7-12,15-16H,2-6,13-14,25H2,1H3 |
| InChIKey | UVSOAPXZXHDVHQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |