C20H23F2NO — CID 163615005
4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexan-1-amine (PubChem CID 163615005) has the molecular formula C20H23F2NO and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexan-1-amine.
| Compound Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 163615005 |
| Molecular Formula | C20H23F2NO |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]cyclohexan-1-amine |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(N)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C20H23F2NO/c1-2-24-18-12-11-17(19(21)20(18)22)15-5-3-13(4-6-15)14-7-9-16(23)10-8-14/h3-6,11-12,14,16H,2,7-10,23H2,1H3 |
| InChIKey | HJFSNOZIHWGUAL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |