C22H27F2OSi — CID 67612605
CID 67612605 (PubChem CID 67612605) has the molecular formula C22H27F2OSi and a molecular weight of 373.54 g/mol.
| Compound Name | CID 67612605 |
|---|---|
| PubChem CID | 67612605 |
| Molecular Formula | C22H27F2OSi |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | — |
| SMILES | CCC[Si]1CCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C22H27F2OSi/c1-3-13-26-14-11-17(12-15-26)16-5-7-18(8-6-16)19-9-10-20(25-4-2)22(24)21(19)23/h5-10,17H,3-4,11-15H2,1-2H3 |
| InChIKey | SOCXPBHQEOPMPO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|