C30H41F2OSi — CID 19609427
CID 19609427 (PubChem CID 19609427) has the molecular formula C30H41F2OSi and a molecular weight of 483.74 g/mol.
| Compound Name | CID 19609427 |
|---|---|
| PubChem CID | 19609427 |
| Molecular Formula | C30H41F2OSi |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(C2CCC(c3ccc(-c4ccc(OCC)c(F)c4F)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H41F2OSi/c1-3-5-6-19-34-20-17-25(18-21-34)24-9-7-22(8-10-24)23-11-13-26(14-12-23)27-15-16-28(33-4-2)30(32)29(27)31/h11-16,22,24-25H,3-10,17-21H2,1-2H3 |
| InChIKey | LQQIGXYPJFBUCB-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|