C30H40F2O — CID 20809263
(2R,4aR,8aR)-2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809263) has the molecular formula C30H40F2O and a molecular weight of 454.65 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809263 |
| Molecular Formula | C30H40F2O |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OCC)c(F)c4F)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C30H40F2O/c1-3-5-6-7-8-21-9-10-26-20-25(16-15-24(26)19-21)22-11-13-23(14-12-22)27-17-18-28(33-4-2)30(32)29(27)31/h11-14,17-18,21,24-26H,3-10,15-16,19-20H2,1-2H3/t21?,24-,25-,26-/m1/s1 |
| InChIKey | SSEYRMCVSMNBRI-ZSZFIPSZSA-N |
| XLogP | 9.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|