C29H39F — CID 20809496
(2R,4aR,8aR)-2-[4-(4-fluorophenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809496) has the molecular formula C29H39F and a molecular weight of 406.63 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(4-fluorophenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(4-fluorophenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809496 |
| Molecular Formula | C29H39F |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(4-fluorophenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(F)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C29H39F/c1-2-3-4-5-6-7-22-8-9-28-21-27(15-14-26(28)20-22)25-12-10-23(11-13-25)24-16-18-29(30)19-17-24/h10-13,16-19,22,26-28H,2-9,14-15,20-21H2,1H3/t22?,26-,27-,28-/m1/s1 |
| InChIKey | AEZZLMHBLATAIY-ZQCUGPNOSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|