C31H39F — CID 20809803
(2R,4aR,8aR)-2-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809803) has the molecular formula C31H39F and a molecular weight of 430.65 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809803 |
| Molecular Formula | C31H39F |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCCC1CC[C@@H]2C[C@H](c3ccc(C#Cc4ccc(F)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C31H39F/c1-2-3-4-5-6-7-26-12-17-30-23-29(19-18-28(30)22-26)27-15-10-24(11-16-27)8-9-25-13-20-31(32)21-14-25/h10-11,13-16,20-21,26,28-30H,2-7,12,17-19,22-23H2,1H3/t26?,28-,29-,30-/m1/s1 |
| InChIKey | YDIKZXVMTDMCKP-IQNHQVHKSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|