C22H34 — CID 20809581
(4aR,6R,8aR)-2-hexyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809581) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-hexyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-hexyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809581 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (4aR,6R,8aR)-2-hexyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCC1CC[C@@H]2C[C@H](c3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C22H34/c1-2-3-4-6-9-18-12-13-22-17-21(15-14-20(22)16-18)19-10-7-5-8-11-19/h5,7-8,10-11,18,20-22H,2-4,6,9,12-17H2,1H3/t18?,20-,21-,22-/m1/s1 |
| InChIKey | QOYAKEZUJZCJQT-BADLGMOZSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|