C31H44 — CID 20809518
(4aR,6R,8aR)-2-hexyl-6-[4-(4-propylphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809518) has the molecular formula C31H44 and a molecular weight of 416.69 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-hexyl-6-[4-(4-propylphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-hexyl-6-[4-(4-propylphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809518 |
| Molecular Formula | C31H44 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | (4aR,6R,8aR)-2-hexyl-6-[4-(4-propylphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(CCC)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C31H44/c1-3-5-6-7-9-25-12-15-31-23-30(21-20-29(31)22-25)28-18-16-27(17-19-28)26-13-10-24(8-4-2)11-14-26/h10-11,13-14,16-19,25,29-31H,3-9,12,15,20-23H2,1-2H3/t25?,29-,30-,31-/m1/s1 |
| InChIKey | LEMJINVSHNZIQJ-BBCLLFSUSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|