C34H42O — CID 20809464
(4aR,6R,8aR)-2-pentyl-6-[4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809464) has the molecular formula C34H42O and a molecular weight of 466.71 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-pentyl-6-[4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-pentyl-6-[4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809464 |
| Molecular Formula | C34H42O |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | (4aR,6R,8aR)-2-pentyl-6-[4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OCc5ccccc5)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C34H42O/c1-2-3-5-8-26-11-12-33-24-32(18-17-31(33)23-26)30-15-13-28(14-16-30)29-19-21-34(22-20-29)35-25-27-9-6-4-7-10-27/h4,6-7,9-10,13-16,19-22,26,31-33H,2-3,5,8,11-12,17-18,23-25H2,1H3/t26?,31-,32-,33-/m1/s1 |
| InChIKey | RUHAEXIZMNORFP-RICDVKGYSA-N |
| XLogP | 9.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|