C23H36 — CID 22384134
2-heptyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22384134) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-heptyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-heptyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22384134 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 2-heptyl-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCCC1CCC2CC(c3ccccc3)CCC2C1 |
| InChI | InChI=1S/C23H36/c1-2-3-4-5-7-10-19-13-14-23-18-22(16-15-21(23)17-19)20-11-8-6-9-12-20/h6,8-9,11-12,19,21-23H,2-5,7,10,13-18H2,1H3 |
| InChIKey | ZBOWVUNJCLJHRA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|