C17H16F2O2 — CID 67957771
2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]oxetane (PubChem CID 67957771) has the molecular formula C17H16F2O2 and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]oxetane.
| Compound Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]oxetane |
|---|---|
| PubChem CID | 67957771 |
| Molecular Formula | C17H16F2O2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]oxetane |
| SMILES | CCOc1ccc(-c2ccc(C3CCO3)cc2)c(F)c1F |
| InChI | InChI=1S/C17H16F2O2/c1-2-20-15-8-7-13(16(18)17(15)19)11-3-5-12(6-4-11)14-9-10-21-14/h3-8,14H,2,9-10H2,1H3 |
| InChIKey | RTXMNROAGGGRKM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |