C24H28F2O2 — CID 122480114
2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-pentyl-3,6-dihydro-2H-pyran (PubChem CID 122480114) has the molecular formula C24H28F2O2 and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-pentyl-3,6-dihydro-2H-pyran.
| Compound Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-pentyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 122480114 |
| Molecular Formula | C24H28F2O2 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-5-pentyl-3,6-dihydro-2H-pyran |
| SMILES | CCCCCC1=CCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)OC1 |
| InChI | InChI=1S/C24H28F2O2/c1-3-5-6-7-17-8-14-21(28-16-17)19-11-9-18(10-12-19)20-13-15-22(27-4-2)24(26)23(20)25/h8-13,15,21H,3-7,14,16H2,1-2H3 |
| InChIKey | JENKTQCXHAWCPQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|